X8Q
Psilocybin
| Created: | 2023-10-25 |
| Last modified: | 2024-11-11 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 36 |
| Chiral Atom Count | 0 |
| Bond Count | 37 |
| Aromatic Bond Count | 10 |
Chemical Component Summary | |
|---|---|
| Name | Psilocybin |
| Synonyms | [3-[2-(dimethylamino)ethyl]-1~{H}-indol-4-yl] dihydrogen phosphate |
| Systematic Name (OpenEye OEToolkits) | [3-[2-(dimethylamino)ethyl]-1~{H}-indol-4-yl] dihydrogen phosphate |
| Formula | C12 H17 N2 O4 P |
| Molecular Weight | 284.248 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | CN(C)CCc1c[nH]c2cccc(O[P](O)(O)=O)c12 |
| SMILES | OpenEye OEToolkits | 2.0.7 | CN(C)CCc1c[nH]c2c1c(ccc2)OP(=O)(O)O |
| Canonical SMILES | CACTVS | 3.385 | CN(C)CCc1c[nH]c2cccc(O[P](O)(O)=O)c12 |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | CN(C)CCc1c[nH]c2c1c(ccc2)OP(=O)(O)O |
| InChI | InChI | 1.06 | InChI=1S/C12H17N2O4P/c1-14(2)7-6-9-8-13-10-4-3-5-11(12(9)10)18-19(15,16)17/h3-5,8,13H,6-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | InChI | 1.06 | QVDSEJDULKLHCG-UHFFFAOYSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB11664 |
|---|---|
| Name | Psilocybin |
| Groups | investigational |
| Description | Psilocybin has been investigated for the treatment of Anxiety and Stage IV Melanoma. In November, 2019, it was granted Breakthrough Therapy status by the FDA. |
| Synonyms |
|
| Categories |
|
| CAS number | 520-52-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL194378 |
| PubChem | 10624, 138543650 |
| ChEMBL | CHEMBL194378 |
| ChEBI | CHEBI:8614 |














