MEF
N-({4-[(6aR)-3-amino-1-oxo-1,2,5,6,6a,7-hexahydroimidazo[1,5-f]pteridin-8(9H)-yl]phenyl}carbonyl)-L-glutamic acid
| Created: | 2007-12-05 |
| Last modified: | 2021-03-13 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 56 |
| Chiral Atom Count | 2 |
| Bond Count | 59 |
| Aromatic Bond Count | 6 |
Chemical Component Summary | |
|---|---|
| Name | N-({4-[(6aR)-3-amino-1-oxo-1,2,5,6,6a,7-hexahydroimidazo[1,5-f]pteridin-8(9H)-yl]phenyl}carbonyl)-L-glutamic acid |
| Synonyms | 5,10-methylene,5,6,7,8-tetrahydrofolate |
| Systematic Name (OpenEye OEToolkits) | (2S)-2-[[4-[(6aR,8R)-3-amino-1-oxo-2,5,6,6a,7,9-hexahydroimidazo[3,4-f]pteridin-8-yl]phenyl]carbonylamino]pentanedioic acid |
| Formula | C20 H23 N7 O6 |
| Molecular Weight | 457.44 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | ACDLabs | 10.04 | O=C(O)C(NC(=O)c1ccc(cc1)N4CC3N(C=2C(=O)NC(=NC=2NC3)N)C4)CCC(=O)O |
| SMILES | CACTVS | 3.341 | NC1=NC2=C(N3CN(C[CH]3CN2)c4ccc(cc4)C(=O)N[CH](CCC(O)=O)C(O)=O)C(=O)N1 |
| SMILES | OpenEye OEToolkits | 1.5.0 | c1cc(ccc1C(=O)NC(CCC(=O)O)C(=O)O)N2CC3CNC4=C(N3C2)C(=O)NC(=N4)N |
| Canonical SMILES | CACTVS | 3.341 | NC1=NC2=C(N3CN(C[C@H]3CN2)c4ccc(cc4)C(=O)N[C@@H](CCC(O)=O)C(O)=O)C(=O)N1 |
| Canonical SMILES | OpenEye OEToolkits | 1.5.0 | c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)[N@]2C[C@H]3CNC4=C(N3C2)C(=O)NC(=N4)N |
| InChI | InChI | 1.03 | InChI=1S/C20H23N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,12-13H,5-9H2,(H,23,30)(H,28,29)(H,32,33)(H4,21,22,24,25,31)/t12-,13+/m1/s1 |
| InChIKey | InChI | 1.03 | QYNUQALWYRSVHF-OLZOCXBDSA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB12676 |
|---|---|
| Name | Modufolin |
| Groups | investigational |
| Description | Modufolin is under investigation for the treatment of Osteosarcoma. |
| Synonyms |
|
| CAS number | 31690-11-6 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 135398645, 5288808, 445117 |
| ChEMBL | CHEMBL1234270 |
| ChEBI | CHEBI:1989 |














